C21H19N3O4S3 — CID 55505693
2,2-dioxo-N-[3-(thiophene-2-carbonyl)-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-3,4-dihydropyrido[2,1-c][1,2,4]thiadiazine-9-carboxamide (PubChem CID 55505693) has the molecular formula C21H19N3O4S3 and a molecular weight of 473.60 g/mol. Its IUPAC name is 2,2-dioxo-N-[3-(thiophene-2-carbonyl)-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-3,4-dihydropyrido[2,1-c][1,2,4]thiadiazine-9-carboxamide.
| Compound Name | 2,2-dioxo-N-[3-(thiophene-2-carbonyl)-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-3,4-dihydropyrido[2,1-c][1,2,4]thiadiazine-9-carboxamide |
|---|---|
| PubChem CID | 55505693 |
| Molecular Formula | C21H19N3O4S3 |
| Molecular Weight | 473.60 g/mol |
| Exact Mass | 473.05 |
| IUPAC Name | 2,2-dioxo-N-[3-(thiophene-2-carbonyl)-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-3,4-dihydropyrido[2,1-c][1,2,4]thiadiazine-9-carboxamide |
| SMILES | O=C(Nc1sc2c(c1C(=O)c1cccs1)CCCC2)C1=CC=CN2CCS(=O)(=O)N=C12 |
| InChI | InChI=1S/C21H19N3O4S3/c25-18(16-8-4-11-29-16)17-13-5-1-2-7-15(13)30-21(17)22-20(26)14-6-3-9-24-10-12-31(27,28)23-19(14)24/h3-4,6,8-9,11H,1-2,5,7,10,12H2,(H,22,26) |
| InChIKey | UTSJYXWVHZTVJT-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 95.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.60 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |