C27H22N4O3 — CID 55505787
N-[[4-(furan-2-carbonylamino)phenyl]methyl]-2-methyl-1-phenylbenzimidazole-5-carboxamide (PubChem CID 55505787) has the molecular formula C27H22N4O3 and a molecular weight of 450.50 g/mol. Its IUPAC name is N-[[4-(furan-2-carbonylamino)phenyl]methyl]-2-methyl-1-phenylbenzimidazole-5-carboxamide.
| Compound Name | N-[[4-(furan-2-carbonylamino)phenyl]methyl]-2-methyl-1-phenylbenzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 55505787 |
| Molecular Formula | C27H22N4O3 |
| Molecular Weight | 450.50 g/mol |
| Exact Mass | 450.17 |
| IUPAC Name | N-[[4-(furan-2-carbonylamino)phenyl]methyl]-2-methyl-1-phenylbenzimidazole-5-carboxamide |
| SMILES | Cc1nc2cc(C(=O)NCc3ccc(NC(=O)c4ccco4)cc3)ccc2n1-c1ccccc1 |
| InChI | InChI=1S/C27H22N4O3/c1-18-29-23-16-20(11-14-24(23)31(18)22-6-3-2-4-7-22)26(32)28-17-19-9-12-21(13-10-19)30-27(33)25-8-5-15-34-25/h2-16H,17H2,1H3,(H,28,32)(H,30,33) |
| InChIKey | HRHSOSYVCPXXJZ-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 89.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.50 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |