C26H23N5O — CID 56512878
2-methyl-N-[4-[(2-methylimidazol-1-yl)methyl]phenyl]-1-phenylbenzimidazole-5-carboxamide (PubChem CID 56512878) has the molecular formula C26H23N5O and a molecular weight of 421.50 g/mol. Its IUPAC name is 2-methyl-N-[4-[(2-methylimidazol-1-yl)methyl]phenyl]-1-phenylbenzimidazole-5-carboxamide.
| Compound Name | 2-methyl-N-[4-[(2-methylimidazol-1-yl)methyl]phenyl]-1-phenylbenzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 56512878 |
| Molecular Formula | C26H23N5O |
| Molecular Weight | 421.50 g/mol |
| Exact Mass | 421.19 |
| IUPAC Name | 2-methyl-N-[4-[(2-methylimidazol-1-yl)methyl]phenyl]-1-phenylbenzimidazole-5-carboxamide |
| SMILES | Cc1nccn1Cc1ccc(NC(=O)c2ccc3c(c2)nc(C)n3-c2ccccc2)cc1 |
| InChI | InChI=1S/C26H23N5O/c1-18-27-14-15-30(18)17-20-8-11-22(12-9-20)29-26(32)21-10-13-25-24(16-21)28-19(2)31(25)23-6-4-3-5-7-23/h3-16H,17H2,1-2H3,(H,29,32) |
| InChIKey | GXYPZDUXJMYCQN-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 64.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.50 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |