C23H34N2O5 — CID 55507501
[1-[3-methoxy-4-(3-methylbutoxy)benzoyl]piperidin-3-yl]-morpholin-4-ylmethanone (PubChem CID 55507501) has the molecular formula C23H34N2O5 and a molecular weight of 418.53 g/mol. Its IUPAC name is [1-[3-methoxy-4-(3-methylbutoxy)benzoyl]piperidin-3-yl]-morpholin-4-ylmethanone.
| Compound Name | [1-[3-methoxy-4-(3-methylbutoxy)benzoyl]piperidin-3-yl]-morpholin-4-ylmethanone |
|---|---|
| PubChem CID | 55507501 |
| Molecular Formula | C23H34N2O5 |
| Molecular Weight | 418.53 g/mol |
| Exact Mass | 418.25 |
| IUPAC Name | [1-[3-methoxy-4-(3-methylbutoxy)benzoyl]piperidin-3-yl]-morpholin-4-ylmethanone |
| SMILES | COc1cc(C(=O)N2CCCC(C(=O)N3CCOCC3)C2)ccc1OCCC(C)C |
| InChI | InChI=1S/C23H34N2O5/c1-17(2)8-12-30-20-7-6-18(15-21(20)28-3)22(26)25-9-4-5-19(16-25)23(27)24-10-13-29-14-11-24/h6-7,15,17,19H,4-5,8-14,16H2,1-3H3 |
| InChIKey | SAWXJFIHMTUUMX-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 68.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.53 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |