C20H15N3O6S — CID 55507769
(4-methoxy-2-nitrophenyl) 3-methyl-6-(5-methylthiophen-2-yl)-[1,2]oxazolo[5,4-b]pyridine-4-carboxylate (PubChem CID 55507769) has the molecular formula C20H15N3O6S and a molecular weight of 425.42 g/mol. Its IUPAC name is (4-methoxy-2-nitrophenyl) 3-methyl-6-(5-methylthiophen-2-yl)-[1,2]oxazolo[5,4-b]pyridine-4-carboxylate.
| Compound Name | (4-methoxy-2-nitrophenyl) 3-methyl-6-(5-methylthiophen-2-yl)-[1,2]oxazolo[5,4-b]pyridine-4-carboxylate |
|---|---|
| PubChem CID | 55507769 |
| Molecular Formula | C20H15N3O6S |
| Molecular Weight | 425.42 g/mol |
| Exact Mass | 425.07 |
| IUPAC Name | (4-methoxy-2-nitrophenyl) 3-methyl-6-(5-methylthiophen-2-yl)-[1,2]oxazolo[5,4-b]pyridine-4-carboxylate |
| SMILES | COc1ccc(OC(=O)c2cc(-c3ccc(C)s3)nc3onc(C)c23)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C20H15N3O6S/c1-10-4-7-17(30-10)14-9-13(18-11(2)22-29-19(18)21-14)20(24)28-16-6-5-12(27-3)8-15(16)23(25)26/h4-9H,1-3H3 |
| InChIKey | UQTPBEPNIBDHBS-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 117.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.42 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|