C23H27N3O3S — CID 55509742
3-benzoyl-N-methyl-N-[(4-morpholin-4-ylphenyl)methyl]-1,3-thiazolidine-4-carboxamide (PubChem CID 55509742) has the molecular formula C23H27N3O3S and a molecular weight of 425.55 g/mol. Its IUPAC name is 3-benzoyl-N-methyl-N-[(4-morpholin-4-ylphenyl)methyl]-1,3-thiazolidine-4-carboxamide.
| Compound Name | 3-benzoyl-N-methyl-N-[(4-morpholin-4-ylphenyl)methyl]-1,3-thiazolidine-4-carboxamide |
|---|---|
| PubChem CID | 55509742 |
| Molecular Formula | C23H27N3O3S |
| Molecular Weight | 425.55 g/mol |
| Exact Mass | 425.18 |
| IUPAC Name | 3-benzoyl-N-methyl-N-[(4-morpholin-4-ylphenyl)methyl]-1,3-thiazolidine-4-carboxamide |
| SMILES | CN(Cc1ccc(N2CCOCC2)cc1)C(=O)C1CSCN1C(=O)c1ccccc1 |
| InChI | InChI=1S/C23H27N3O3S/c1-24(15-18-7-9-20(10-8-18)25-11-13-29-14-12-25)23(28)21-16-30-17-26(21)22(27)19-5-3-2-4-6-19/h2-10,21H,11-17H2,1H3 |
| InChIKey | QMSIZTURJCFZPN-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 53.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.55 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|