C23H23N3O7S — CID 55510695
1-(2-ethoxyphenyl)-3-[2-(1-methylsulfonyl-3,4-dihydro-2H-quinolin-6-yl)-2-oxoethyl]imidazolidine-2,4,5-trione (PubChem CID 55510695) has the molecular formula C23H23N3O7S and a molecular weight of 485.52 g/mol. Its IUPAC name is 1-(2-ethoxyphenyl)-3-[2-(1-methylsulfonyl-3,4-dihydro-2H-quinolin-6-yl)-2-oxoethyl]imidazolidine-2,4,5-trione.
| Compound Name | 1-(2-ethoxyphenyl)-3-[2-(1-methylsulfonyl-3,4-dihydro-2H-quinolin-6-yl)-2-oxoethyl]imidazolidine-2,4,5-trione |
|---|---|
| PubChem CID | 55510695 |
| Molecular Formula | C23H23N3O7S |
| Molecular Weight | 485.52 g/mol |
| Exact Mass | 485.13 |
| IUPAC Name | 1-(2-ethoxyphenyl)-3-[2-(1-methylsulfonyl-3,4-dihydro-2H-quinolin-6-yl)-2-oxoethyl]imidazolidine-2,4,5-trione |
| SMILES | CCOc1ccccc1N1C(=O)C(=O)N(CC(=O)c2ccc3c(c2)CCCN3S(C)(=O)=O)C1=O |
| InChI | InChI=1S/C23H23N3O7S/c1-3-33-20-9-5-4-8-18(20)26-22(29)21(28)24(23(26)30)14-19(27)16-10-11-17-15(13-16)7-6-12-25(17)34(2,31)32/h4-5,8-11,13H,3,6-7,12,14H2,1-2H3 |
| InChIKey | DNEYGTWQCXLMEQ-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 121.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.52 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|