C18H21N3O6S — CID 8626894
1-[2-(1-methylsulfonyl-3,4-dihydro-2H-quinolin-6-yl)-2-oxoethyl]-3-propylimidazolidine-2,4,5-trione (PubChem CID 8626894) has the molecular formula C18H21N3O6S and a molecular weight of 407.45 g/mol. Its IUPAC name is 1-[2-(1-methylsulfonyl-3,4-dihydro-2H-quinolin-6-yl)-2-oxoethyl]-3-propylimidazolidine-2,4,5-trione.
| Compound Name | 1-[2-(1-methylsulfonyl-3,4-dihydro-2H-quinolin-6-yl)-2-oxoethyl]-3-propylimidazolidine-2,4,5-trione |
|---|---|
| PubChem CID | 8626894 |
| Molecular Formula | C18H21N3O6S |
| Molecular Weight | 407.45 g/mol |
| Exact Mass | 407.12 |
| IUPAC Name | 1-[2-(1-methylsulfonyl-3,4-dihydro-2H-quinolin-6-yl)-2-oxoethyl]-3-propylimidazolidine-2,4,5-trione |
| SMILES | CCCN1C(=O)C(=O)N(CC(=O)c2ccc3c(c2)CCCN3S(C)(=O)=O)C1=O |
| InChI | InChI=1S/C18H21N3O6S/c1-3-8-19-16(23)17(24)20(18(19)25)11-15(22)13-6-7-14-12(10-13)5-4-9-21(14)28(2,26)27/h6-7,10H,3-5,8-9,11H2,1-2H3 |
| InChIKey | GSEZEBBPGXFDQS-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 112.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.45 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|