C20H18N4O7 — CID 55510917
2-[3-(2-ethoxyphenyl)-2,4,5-trioxoimidazolidin-1-yl]-N-(2-methyl-3-nitrophenyl)acetamide (PubChem CID 55510917) has the molecular formula C20H18N4O7 and a molecular weight of 426.39 g/mol. Its IUPAC name is 2-[3-(2-ethoxyphenyl)-2,4,5-trioxoimidazolidin-1-yl]-N-(2-methyl-3-nitrophenyl)acetamide.
| Compound Name | 2-[3-(2-ethoxyphenyl)-2,4,5-trioxoimidazolidin-1-yl]-N-(2-methyl-3-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 55510917 |
| Molecular Formula | C20H18N4O7 |
| Molecular Weight | 426.39 g/mol |
| Exact Mass | 426.12 |
| IUPAC Name | 2-[3-(2-ethoxyphenyl)-2,4,5-trioxoimidazolidin-1-yl]-N-(2-methyl-3-nitrophenyl)acetamide |
| SMILES | CCOc1ccccc1N1C(=O)C(=O)N(CC(=O)Nc2cccc([N+](=O)[O-])c2C)C1=O |
| InChI | InChI=1S/C20H18N4O7/c1-3-31-16-10-5-4-8-15(16)23-19(27)18(26)22(20(23)28)11-17(25)21-13-7-6-9-14(12(13)2)24(29)30/h4-10H,3,11H2,1-2H3,(H,21,25) |
| InChIKey | SWWPEKMQPUPYQM-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 139.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.39 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|