C21H23BrN2O3S — CID 55512939
methyl 1-[2-[2-(3-bromophenyl)-1,3-thiazol-4-yl]acetyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylate (PubChem CID 55512939) has the molecular formula C21H23BrN2O3S and a molecular weight of 463.40 g/mol. Its IUPAC name is methyl 1-[2-[2-(3-bromophenyl)-1,3-thiazol-4-yl]acetyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylate.
| Compound Name | methyl 1-[2-[2-(3-bromophenyl)-1,3-thiazol-4-yl]acetyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylate |
|---|---|
| PubChem CID | 55512939 |
| Molecular Formula | C21H23BrN2O3S |
| Molecular Weight | 463.40 g/mol |
| Exact Mass | 462.06 |
| IUPAC Name | methyl 1-[2-[2-(3-bromophenyl)-1,3-thiazol-4-yl]acetyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylate |
| SMILES | COC(=O)C1CC2CCCCC2N1C(=O)Cc1csc(-c2cccc(Br)c2)n1 |
| InChI | InChI=1S/C21H23BrN2O3S/c1-27-21(26)18-10-13-5-2-3-8-17(13)24(18)19(25)11-16-12-28-20(23-16)14-6-4-7-15(22)9-14/h4,6-7,9,12-13,17-18H,2-3,5,8,10-11H2,1H3 |
| InChIKey | YFSYRBKYBFJWBL-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.40 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |