C25H30N2O4S — CID 55513188
methyl 1-(5-morpholin-4-yl-4-phenylthiophene-2-carbonyl)-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylate (PubChem CID 55513188) has the molecular formula C25H30N2O4S and a molecular weight of 454.59 g/mol. Its IUPAC name is methyl 1-(5-morpholin-4-yl-4-phenylthiophene-2-carbonyl)-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylate.
| Compound Name | methyl 1-(5-morpholin-4-yl-4-phenylthiophene-2-carbonyl)-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylate |
|---|---|
| PubChem CID | 55513188 |
| Molecular Formula | C25H30N2O4S |
| Molecular Weight | 454.59 g/mol |
| Exact Mass | 454.19 |
| IUPAC Name | methyl 1-(5-morpholin-4-yl-4-phenylthiophene-2-carbonyl)-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylate |
| SMILES | COC(=O)C1CC2CCCCC2N1C(=O)c1cc(-c2ccccc2)c(N2CCOCC2)s1 |
| InChI | InChI=1S/C25H30N2O4S/c1-30-25(29)21-15-18-9-5-6-10-20(18)27(21)23(28)22-16-19(17-7-3-2-4-8-17)24(32-22)26-11-13-31-14-12-26/h2-4,7-8,16,18,20-21H,5-6,9-15H2,1H3 |
| InChIKey | XZYZUWOOIJAMJK-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.59 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |