C19H23N3O4S2 — CID 55515725
1-propylsulfonyl-N-[3-(thiophene-2-carbonylamino)phenyl]pyrrolidine-2-carboxamide (PubChem CID 55515725) has the molecular formula C19H23N3O4S2 and a molecular weight of 421.54 g/mol. Its IUPAC name is 1-propylsulfonyl-N-[3-(thiophene-2-carbonylamino)phenyl]pyrrolidine-2-carboxamide.
| Compound Name | 1-propylsulfonyl-N-[3-(thiophene-2-carbonylamino)phenyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 55515725 |
| Molecular Formula | C19H23N3O4S2 |
| Molecular Weight | 421.54 g/mol |
| Exact Mass | 421.11 |
| IUPAC Name | 1-propylsulfonyl-N-[3-(thiophene-2-carbonylamino)phenyl]pyrrolidine-2-carboxamide |
| SMILES | CCCS(=O)(=O)N1CCCC1C(=O)Nc1cccc(NC(=O)c2cccs2)c1 |
| InChI | InChI=1S/C19H23N3O4S2/c1-2-12-28(25,26)22-10-4-8-16(22)18(23)20-14-6-3-7-15(13-14)21-19(24)17-9-5-11-27-17/h3,5-7,9,11,13,16H,2,4,8,10,12H2,1H3,(H,20,23)(H,21,24) |
| InChIKey | KJDPAUZCINMTDQ-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.54 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |