C17H25N3O5S2 — CID 42929323
N-[3-(cyclopropylsulfamoyl)phenyl]-1-propylsulfonylpyrrolidine-2-carboxamide (PubChem CID 42929323) has the molecular formula C17H25N3O5S2 and a molecular weight of 415.54 g/mol. Its IUPAC name is N-[3-(cyclopropylsulfamoyl)phenyl]-1-propylsulfonylpyrrolidine-2-carboxamide.
| Compound Name | N-[3-(cyclopropylsulfamoyl)phenyl]-1-propylsulfonylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 42929323 |
| Molecular Formula | C17H25N3O5S2 |
| Molecular Weight | 415.54 g/mol |
| Exact Mass | 415.12 |
| IUPAC Name | N-[3-(cyclopropylsulfamoyl)phenyl]-1-propylsulfonylpyrrolidine-2-carboxamide |
| SMILES | CCCS(=O)(=O)N1CCCC1C(=O)Nc1cccc(S(=O)(=O)NC2CC2)c1 |
| InChI | InChI=1S/C17H25N3O5S2/c1-2-11-26(22,23)20-10-4-7-16(20)17(21)18-14-5-3-6-15(12-14)27(24,25)19-13-8-9-13/h3,5-6,12-13,16,19H,2,4,7-11H2,1H3,(H,18,21) |
| InChIKey | GZOICVZYWZRCFC-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.54 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |