C17H26ClN3O5S2 — CID 55963352
N-[2-[(3-chlorophenyl)sulfonylamino]ethyl]-1-propylsulfonylpiperidine-2-carboxamide (PubChem CID 55963352) has the molecular formula C17H26ClN3O5S2 and a molecular weight of 452.00 g/mol. Its IUPAC name is N-[2-[(3-chlorophenyl)sulfonylamino]ethyl]-1-propylsulfonylpiperidine-2-carboxamide.
| Compound Name | N-[2-[(3-chlorophenyl)sulfonylamino]ethyl]-1-propylsulfonylpiperidine-2-carboxamide |
|---|---|
| PubChem CID | 55963352 |
| Molecular Formula | C17H26ClN3O5S2 |
| Molecular Weight | 452.00 g/mol |
| Exact Mass | 451.10 |
| IUPAC Name | N-[2-[(3-chlorophenyl)sulfonylamino]ethyl]-1-propylsulfonylpiperidine-2-carboxamide |
| SMILES | CCCS(=O)(=O)N1CCCCC1C(=O)NCCNS(=O)(=O)c1cccc(Cl)c1 |
| InChI | InChI=1S/C17H26ClN3O5S2/c1-2-12-27(23,24)21-11-4-3-8-16(21)17(22)19-9-10-20-28(25,26)15-7-5-6-14(18)13-15/h5-7,13,16,20H,2-4,8-12H2,1H3,(H,19,22) |
| InChIKey | SGRDSJIFEWVRHC-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.00 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|