C19H31N3O5S2 — CID 55965272
N-[2-[(2,5-dimethylphenyl)sulfonylamino]ethyl]-1-propylsulfonylpiperidine-2-carboxamide (PubChem CID 55965272) has the molecular formula C19H31N3O5S2 and a molecular weight of 445.61 g/mol. Its IUPAC name is N-[2-[(2,5-dimethylphenyl)sulfonylamino]ethyl]-1-propylsulfonylpiperidine-2-carboxamide.
| Compound Name | N-[2-[(2,5-dimethylphenyl)sulfonylamino]ethyl]-1-propylsulfonylpiperidine-2-carboxamide |
|---|---|
| PubChem CID | 55965272 |
| Molecular Formula | C19H31N3O5S2 |
| Molecular Weight | 445.61 g/mol |
| Exact Mass | 445.17 |
| IUPAC Name | N-[2-[(2,5-dimethylphenyl)sulfonylamino]ethyl]-1-propylsulfonylpiperidine-2-carboxamide |
| SMILES | CCCS(=O)(=O)N1CCCCC1C(=O)NCCNS(=O)(=O)c1cc(C)ccc1C |
| InChI | InChI=1S/C19H31N3O5S2/c1-4-13-28(24,25)22-12-6-5-7-17(22)19(23)20-10-11-21-29(26,27)18-14-15(2)8-9-16(18)3/h8-9,14,17,21H,4-7,10-13H2,1-3H3,(H,20,23) |
| InChIKey | UNRSLCMGBQFMOB-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.61 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|