C18H25N3O4S — CID 166410994
N-[2-[(2,5-dimethylphenyl)sulfonylamino]ethyl]-1-prop-2-enoylpyrrolidine-2-carboxamide (PubChem CID 166410994) has the molecular formula C18H25N3O4S and a molecular weight of 379.48 g/mol. Its IUPAC name is N-[2-[(2,5-dimethylphenyl)sulfonylamino]ethyl]-1-prop-2-enoylpyrrolidine-2-carboxamide.
| Compound Name | N-[2-[(2,5-dimethylphenyl)sulfonylamino]ethyl]-1-prop-2-enoylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 166410994 |
| Molecular Formula | C18H25N3O4S |
| Molecular Weight | 379.48 g/mol |
| Exact Mass | 379.16 |
| IUPAC Name | N-[2-[(2,5-dimethylphenyl)sulfonylamino]ethyl]-1-prop-2-enoylpyrrolidine-2-carboxamide |
| SMILES | C=CC(=O)N1CCCC1C(=O)NCCNS(=O)(=O)c1cc(C)ccc1C |
| InChI | InChI=1S/C18H25N3O4S/c1-4-17(22)21-11-5-6-15(21)18(23)19-9-10-20-26(24,25)16-12-13(2)7-8-14(16)3/h4,7-8,12,15,20H,1,5-6,9-11H2,2-3H3,(H,19,23) |
| InChIKey | QRESUKFFKMIMIQ-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.48 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|