C19H22N2O4S — CID 51113538
N-[2-[(2,5-dimethylphenyl)sulfonylamino]ethyl]-2,3-dihydro-1-benzofuran-2-carboxamide (PubChem CID 51113538) has the molecular formula C19H22N2O4S and a molecular weight of 374.46 g/mol. Its IUPAC name is N-[2-[(2,5-dimethylphenyl)sulfonylamino]ethyl]-2,3-dihydro-1-benzofuran-2-carboxamide.
| Compound Name | N-[2-[(2,5-dimethylphenyl)sulfonylamino]ethyl]-2,3-dihydro-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 51113538 |
| Molecular Formula | C19H22N2O4S |
| Molecular Weight | 374.46 g/mol |
| Exact Mass | 374.13 |
| IUPAC Name | N-[2-[(2,5-dimethylphenyl)sulfonylamino]ethyl]-2,3-dihydro-1-benzofuran-2-carboxamide |
| SMILES | Cc1ccc(C)c(S(=O)(=O)NCCNC(=O)C2Cc3ccccc3O2)c1 |
| InChI | InChI=1S/C19H22N2O4S/c1-13-7-8-14(2)18(11-13)26(23,24)21-10-9-20-19(22)17-12-15-5-3-4-6-16(15)25-17/h3-8,11,17,21H,9-10,12H2,1-2H3,(H,20,22) |
| InChIKey | LCTFRQAPQKDZKN-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.46 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|