C19H32N4O5S — CID 51962435
(2S)-N-[3-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)propyl]-1-propylsulfonylpiperidine-2-carboxamide (PubChem CID 51962435) has the molecular formula C19H32N4O5S and a molecular weight of 428.56 g/mol. Its IUPAC name is (2S)-N-[3-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)propyl]-1-propylsulfonylpiperidine-2-carboxamide.
| Compound Name | (2S)-N-[3-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)propyl]-1-propylsulfonylpiperidine-2-carboxamide |
|---|---|
| PubChem CID | 51962435 |
| Molecular Formula | C19H32N4O5S |
| Molecular Weight | 428.56 g/mol |
| Exact Mass | 428.21 |
| IUPAC Name | (2S)-N-[3-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)propyl]-1-propylsulfonylpiperidine-2-carboxamide |
| SMILES | CCCS(=O)(=O)N1CCCC[C@H]1C(=O)NCCCN1C(=O)NC2(CCCC2)C1=O |
| InChI | InChI=1S/C19H32N4O5S/c1-2-14-29(27,28)23-13-6-3-8-15(23)16(24)20-11-7-12-22-17(25)19(21-18(22)26)9-4-5-10-19/h15H,2-14H2,1H3,(H,20,24)(H,21,26)/t15-/m0/s1 |
| InChIKey | LXBPHUYGOPCCJJ-HNNXBMFYSA-N |
| XLogP | 0.95 |
| TPSA | 115.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.56 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|