C19H32N6O3S — CID 55618309
1-propylsulfonyl-N-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]pyrrolidine-2-carboxamide (PubChem CID 55618309) has the molecular formula C19H32N6O3S and a molecular weight of 424.57 g/mol. Its IUPAC name is 1-propylsulfonyl-N-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]pyrrolidine-2-carboxamide.
| Compound Name | 1-propylsulfonyl-N-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 55618309 |
| Molecular Formula | C19H32N6O3S |
| Molecular Weight | 424.57 g/mol |
| Exact Mass | 424.23 |
| IUPAC Name | 1-propylsulfonyl-N-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]pyrrolidine-2-carboxamide |
| SMILES | CCCS(=O)(=O)N1CCCC1C(=O)NCCCN1CCN(c2ncccn2)CC1 |
| InChI | InChI=1S/C19H32N6O3S/c1-2-16-29(27,28)25-11-3-6-17(25)18(26)20-9-5-10-23-12-14-24(15-13-23)19-21-7-4-8-22-19/h4,7-8,17H,2-3,5-6,9-16H2,1H3,(H,20,26) |
| InChIKey | MRXRPMCNLKILOI-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.57 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|