C19H28N4O4 — CID 36868629
(3R)-1-cyclopropyl-N-[3-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)propyl]-5-oxopyrrolidine-3-carboxamide (PubChem CID 36868629) has the molecular formula C19H28N4O4 and a molecular weight of 376.46 g/mol. Its IUPAC name is (3R)-1-cyclopropyl-N-[3-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)propyl]-5-oxopyrrolidine-3-carboxamide.
| Compound Name | (3R)-1-cyclopropyl-N-[3-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)propyl]-5-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 36868629 |
| Molecular Formula | C19H28N4O4 |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.21 |
| IUPAC Name | (3R)-1-cyclopropyl-N-[3-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)propyl]-5-oxopyrrolidine-3-carboxamide |
| SMILES | O=C(NCCCN1C(=O)NC2(CCCCC2)C1=O)[C@@H]1CC(=O)N(C2CC2)C1 |
| InChI | InChI=1S/C19H28N4O4/c24-15-11-13(12-23(15)14-5-6-14)16(25)20-9-4-10-22-17(26)19(21-18(22)27)7-2-1-3-8-19/h13-14H,1-12H2,(H,20,25)(H,21,27)/t13-/m1/s1 |
| InChIKey | VLTGOCAETIOILQ-CYBMUJFWSA-N |
| XLogP | 0.76 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|