C16H24N4O4S — CID 52501101
(4S)-3-acetyl-N-[3-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)propyl]-1,3-thiazolidine-4-carboxamide (PubChem CID 52501101) has the molecular formula C16H24N4O4S and a molecular weight of 368.46 g/mol. Its IUPAC name is (4S)-3-acetyl-N-[3-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)propyl]-1,3-thiazolidine-4-carboxamide.
| Compound Name | (4S)-3-acetyl-N-[3-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)propyl]-1,3-thiazolidine-4-carboxamide |
|---|---|
| PubChem CID | 52501101 |
| Molecular Formula | C16H24N4O4S |
| Molecular Weight | 368.46 g/mol |
| Exact Mass | 368.15 |
| IUPAC Name | (4S)-3-acetyl-N-[3-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)propyl]-1,3-thiazolidine-4-carboxamide |
| SMILES | CC(=O)N1CSC[C@@H]1C(=O)NCCCN1C(=O)NC2(CCCC2)C1=O |
| InChI | InChI=1S/C16H24N4O4S/c1-11(21)20-10-25-9-12(20)13(22)17-7-4-8-19-14(23)16(18-15(19)24)5-2-3-6-16/h12H,2-10H2,1H3,(H,17,22)(H,18,24)/t12-/m1/s1 |
| InChIKey | PCGFUEXVHBGOCZ-GFCCVEGCSA-N |
| XLogP | 0.28 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.46 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|