C19H25N3O4 — CID 41491110
N-[3-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)propyl]-4-ethoxybenzamide (PubChem CID 41491110) has the molecular formula C19H25N3O4 and a molecular weight of 359.43 g/mol. Its IUPAC name is N-[3-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)propyl]-4-ethoxybenzamide.
| Compound Name | N-[3-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)propyl]-4-ethoxybenzamide |
|---|---|
| PubChem CID | 41491110 |
| Molecular Formula | C19H25N3O4 |
| Molecular Weight | 359.43 g/mol |
| Exact Mass | 359.18 |
| IUPAC Name | N-[3-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)propyl]-4-ethoxybenzamide |
| SMILES | CCOc1ccc(C(=O)NCCCN2C(=O)NC3(CCCC3)C2=O)cc1 |
| InChI | InChI=1S/C19H25N3O4/c1-2-26-15-8-6-14(7-9-15)16(23)20-12-5-13-22-17(24)19(21-18(22)25)10-3-4-11-19/h6-9H,2-5,10-13H2,1H3,(H,20,23)(H,21,25) |
| InChIKey | LPTJCQBPBVXYDQ-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.43 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|