C15H22ClN3O3S — CID 45353186
N'-(3-chloro-4-methylphenyl)-1-propylsulfonylpyrrolidine-2-carbohydrazide (PubChem CID 45353186) has the molecular formula C15H22ClN3O3S and a molecular weight of 359.88 g/mol. Its IUPAC name is N'-(3-chloro-4-methylphenyl)-1-propylsulfonylpyrrolidine-2-carbohydrazide.
| Compound Name | N'-(3-chloro-4-methylphenyl)-1-propylsulfonylpyrrolidine-2-carbohydrazide |
|---|---|
| PubChem CID | 45353186 |
| Molecular Formula | C15H22ClN3O3S |
| Molecular Weight | 359.88 g/mol |
| Exact Mass | 359.11 |
| IUPAC Name | N'-(3-chloro-4-methylphenyl)-1-propylsulfonylpyrrolidine-2-carbohydrazide |
| SMILES | CCCS(=O)(=O)N1CCCC1C(=O)NNc1ccc(C)c(Cl)c1 |
| InChI | InChI=1S/C15H22ClN3O3S/c1-3-9-23(21,22)19-8-4-5-14(19)15(20)18-17-12-7-6-11(2)13(16)10-12/h6-7,10,14,17H,3-5,8-9H2,1-2H3,(H,18,20) |
| InChIKey | SRZVASKUADEKST-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.88 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|