C20H30ClN3O5S — CID 55997742
N'-[4-(4-chloro-2-methylphenoxy)butanoyl]-1-propylsulfonylpiperidine-2-carbohydrazide (PubChem CID 55997742) has the molecular formula C20H30ClN3O5S and a molecular weight of 460.00 g/mol. Its IUPAC name is N'-[4-(4-chloro-2-methylphenoxy)butanoyl]-1-propylsulfonylpiperidine-2-carbohydrazide.
| Compound Name | N'-[4-(4-chloro-2-methylphenoxy)butanoyl]-1-propylsulfonylpiperidine-2-carbohydrazide |
|---|---|
| PubChem CID | 55997742 |
| Molecular Formula | C20H30ClN3O5S |
| Molecular Weight | 460.00 g/mol |
| Exact Mass | 459.16 |
| IUPAC Name | N'-[4-(4-chloro-2-methylphenoxy)butanoyl]-1-propylsulfonylpiperidine-2-carbohydrazide |
| SMILES | CCCS(=O)(=O)N1CCCCC1C(=O)NNC(=O)CCCOc1ccc(Cl)cc1C |
| InChI | InChI=1S/C20H30ClN3O5S/c1-3-13-30(27,28)24-11-5-4-7-17(24)20(26)23-22-19(25)8-6-12-29-18-10-9-16(21)14-15(18)2/h9-10,14,17H,3-8,11-13H2,1-2H3,(H,22,25)(H,23,26) |
| InChIKey | RPFFNQISBIVKNV-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.00 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|