C22H27ClN4O5S — CID 30885852
N'-[4-(4-chloro-2-methylphenoxy)butanoyl]-1-pyridin-3-ylsulfonylpiperidine-4-carbohydrazide (PubChem CID 30885852) has the molecular formula C22H27ClN4O5S and a molecular weight of 495.00 g/mol. Its IUPAC name is N'-[4-(4-chloro-2-methylphenoxy)butanoyl]-1-pyridin-3-ylsulfonylpiperidine-4-carbohydrazide.
| Compound Name | N'-[4-(4-chloro-2-methylphenoxy)butanoyl]-1-pyridin-3-ylsulfonylpiperidine-4-carbohydrazide |
|---|---|
| PubChem CID | 30885852 |
| Molecular Formula | C22H27ClN4O5S |
| Molecular Weight | 495.00 g/mol |
| Exact Mass | 494.14 |
| IUPAC Name | N'-[4-(4-chloro-2-methylphenoxy)butanoyl]-1-pyridin-3-ylsulfonylpiperidine-4-carbohydrazide |
| SMILES | Cc1cc(Cl)ccc1OCCCC(=O)NNC(=O)C1CCN(S(=O)(=O)c2cccnc2)CC1 |
| InChI | InChI=1S/C22H27ClN4O5S/c1-16-14-18(23)6-7-20(16)32-13-3-5-21(28)25-26-22(29)17-8-11-27(12-9-17)33(30,31)19-4-2-10-24-15-19/h2,4,6-7,10,14-15,17H,3,5,8-9,11-13H2,1H3,(H,25,28)(H,26,29) |
| InChIKey | JOGIIKIIXPUWQZ-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 117.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.00 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|