C22H26ClN3O5S — CID 24634883
N'-[4-(4-chloro-2-methylphenoxy)butanoyl]-4-pyrrolidin-1-ylsulfonylbenzohydrazide (PubChem CID 24634883) has the molecular formula C22H26ClN3O5S and a molecular weight of 479.99 g/mol. Its IUPAC name is N'-[4-(4-chloro-2-methylphenoxy)butanoyl]-4-pyrrolidin-1-ylsulfonylbenzohydrazide.
| Compound Name | N'-[4-(4-chloro-2-methylphenoxy)butanoyl]-4-pyrrolidin-1-ylsulfonylbenzohydrazide |
|---|---|
| PubChem CID | 24634883 |
| Molecular Formula | C22H26ClN3O5S |
| Molecular Weight | 479.99 g/mol |
| Exact Mass | 479.13 |
| IUPAC Name | N'-[4-(4-chloro-2-methylphenoxy)butanoyl]-4-pyrrolidin-1-ylsulfonylbenzohydrazide |
| SMILES | Cc1cc(Cl)ccc1OCCCC(=O)NNC(=O)c1ccc(S(=O)(=O)N2CCCC2)cc1 |
| InChI | InChI=1S/C22H26ClN3O5S/c1-16-15-18(23)8-11-20(16)31-14-4-5-21(27)24-25-22(28)17-6-9-19(10-7-17)32(29,30)26-12-2-3-13-26/h6-11,15H,2-5,12-14H2,1H3,(H,24,27)(H,25,28) |
| InChIKey | RKPQPGZVLRNWFT-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.99 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|