C24H20N4O3S — CID 55517520
(E)-3-(2,3-dihydro-1,4-benzodioxin-6-yl)-N-[5-(1-methylimidazol-2-yl)-4-phenyl-1,3-thiazol-2-yl]prop-2-enamide (PubChem CID 55517520) has the molecular formula C24H20N4O3S and a molecular weight of 444.52 g/mol. Its IUPAC name is (E)-3-(2,3-dihydro-1,4-benzodioxin-6-yl)-N-[5-(1-methylimidazol-2-yl)-4-phenyl-1,3-thiazol-2-yl]prop-2-enamide.
| Compound Name | (E)-3-(2,3-dihydro-1,4-benzodioxin-6-yl)-N-[5-(1-methylimidazol-2-yl)-4-phenyl-1,3-thiazol-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 55517520 |
| Molecular Formula | C24H20N4O3S |
| Molecular Weight | 444.52 g/mol |
| Exact Mass | 444.13 |
| IUPAC Name | (E)-3-(2,3-dihydro-1,4-benzodioxin-6-yl)-N-[5-(1-methylimidazol-2-yl)-4-phenyl-1,3-thiazol-2-yl]prop-2-enamide |
| SMILES | Cn1ccnc1-c1sc(NC(=O)/C=C/c2ccc3c(c2)OCCO3)nc1-c1ccccc1 |
| InChI | InChI=1S/C24H20N4O3S/c1-28-12-11-25-23(28)22-21(17-5-3-2-4-6-17)27-24(32-22)26-20(29)10-8-16-7-9-18-19(15-16)31-14-13-30-18/h2-12,15H,13-14H2,1H3,(H,26,27,29)/b10-8+ |
| InChIKey | LOTLJZOHXYQBEM-CSKARUKUSA-N |
| XLogP | 4.63 |
| TPSA | 78.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.52 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|