C21H18N4O3 — CID 55517644
2-methyl-1,3-dioxo-N-[2-(1-phenylpyrazol-4-yl)ethyl]isoindole-5-carboxamide (PubChem CID 55517644) has the molecular formula C21H18N4O3 and a molecular weight of 374.40 g/mol. Its IUPAC name is 2-methyl-1,3-dioxo-N-[2-(1-phenylpyrazol-4-yl)ethyl]isoindole-5-carboxamide.
| Compound Name | 2-methyl-1,3-dioxo-N-[2-(1-phenylpyrazol-4-yl)ethyl]isoindole-5-carboxamide |
|---|---|
| PubChem CID | 55517644 |
| Molecular Formula | C21H18N4O3 |
| Molecular Weight | 374.40 g/mol |
| Exact Mass | 374.14 |
| IUPAC Name | 2-methyl-1,3-dioxo-N-[2-(1-phenylpyrazol-4-yl)ethyl]isoindole-5-carboxamide |
| SMILES | CN1C(=O)c2ccc(C(=O)NCCc3cnn(-c4ccccc4)c3)cc2C1=O |
| InChI | InChI=1S/C21H18N4O3/c1-24-20(27)17-8-7-15(11-18(17)21(24)28)19(26)22-10-9-14-12-23-25(13-14)16-5-3-2-4-6-16/h2-8,11-13H,9-10H2,1H3,(H,22,26) |
| InChIKey | WOOVDAKLJOZLSU-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.40 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|