C19H23N5O — CID 70773858
1-methyl-N-[2-(1-phenylpyrazol-4-yl)ethyl]-3-propan-2-ylpyrazole-5-carboxamide (PubChem CID 70773858) has the molecular formula C19H23N5O and a molecular weight of 337.43 g/mol. Its IUPAC name is 1-methyl-N-[2-(1-phenylpyrazol-4-yl)ethyl]-3-propan-2-ylpyrazole-5-carboxamide.
| Compound Name | 1-methyl-N-[2-(1-phenylpyrazol-4-yl)ethyl]-3-propan-2-ylpyrazole-5-carboxamide |
|---|---|
| PubChem CID | 70773858 |
| Molecular Formula | C19H23N5O |
| Molecular Weight | 337.43 g/mol |
| Exact Mass | 337.19 |
| IUPAC Name | 1-methyl-N-[2-(1-phenylpyrazol-4-yl)ethyl]-3-propan-2-ylpyrazole-5-carboxamide |
| SMILES | CC(C)c1cc(C(=O)NCCc2cnn(-c3ccccc3)c2)n(C)n1 |
| InChI | InChI=1S/C19H23N5O/c1-14(2)17-11-18(23(3)22-17)19(25)20-10-9-15-12-21-24(13-15)16-7-5-4-6-8-16/h4-8,11-14H,9-10H2,1-3H3,(H,20,25) |
| InChIKey | GXOPPLHILAEPAR-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 64.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.43 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |