C19H20N4O6 — CID 55518148
[1-(4-carbamoylanilino)-1-oxopropan-2-yl] 3-(2-nitroanilino)propanoate (PubChem CID 55518148) has the molecular formula C19H20N4O6 and a molecular weight of 400.39 g/mol. Its IUPAC name is [1-(4-carbamoylanilino)-1-oxopropan-2-yl] 3-(2-nitroanilino)propanoate.
| Compound Name | [1-(4-carbamoylanilino)-1-oxopropan-2-yl] 3-(2-nitroanilino)propanoate |
|---|---|
| PubChem CID | 55518148 |
| Molecular Formula | C19H20N4O6 |
| Molecular Weight | 400.39 g/mol |
| Exact Mass | 400.14 |
| IUPAC Name | [1-(4-carbamoylanilino)-1-oxopropan-2-yl] 3-(2-nitroanilino)propanoate |
| SMILES | CC(OC(=O)CCNc1ccccc1[N+](=O)[O-])C(=O)Nc1ccc(C(N)=O)cc1 |
| InChI | InChI=1S/C19H20N4O6/c1-12(19(26)22-14-8-6-13(7-9-14)18(20)25)29-17(24)10-11-21-15-4-2-3-5-16(15)23(27)28/h2-9,12,21H,10-11H2,1H3,(H2,20,25)(H,22,26) |
| InChIKey | WAHXBHGETGOOIM-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 153.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.39 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|