C14H18N4O5S — CID 55520259
4-(butan-2-ylsulfamoyl)-N-(2,4-dioxoimidazolidin-1-yl)benzamide (PubChem CID 55520259) has the molecular formula C14H18N4O5S and a molecular weight of 354.39 g/mol. Its IUPAC name is 4-(butan-2-ylsulfamoyl)-N-(2,4-dioxoimidazolidin-1-yl)benzamide.
| Compound Name | 4-(butan-2-ylsulfamoyl)-N-(2,4-dioxoimidazolidin-1-yl)benzamide |
|---|---|
| PubChem CID | 55520259 |
| Molecular Formula | C14H18N4O5S |
| Molecular Weight | 354.39 g/mol |
| Exact Mass | 354.10 |
| IUPAC Name | 4-(butan-2-ylsulfamoyl)-N-(2,4-dioxoimidazolidin-1-yl)benzamide |
| SMILES | CCC(C)NS(=O)(=O)c1ccc(C(=O)NN2CC(=O)NC2=O)cc1 |
| InChI | InChI=1S/C14H18N4O5S/c1-3-9(2)17-24(22,23)11-6-4-10(5-7-11)13(20)16-18-8-12(19)15-14(18)21/h4-7,9,17H,3,8H2,1-2H3,(H,16,20)(H,15,19,21) |
| InChIKey | QPUAYQKNECPRJR-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 124.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.39 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|