C19H20N2O3 — CID 55520934
N-benzyl-N-butan-2-yl-5-(furan-2-yl)-1,2-oxazole-3-carboxamide (PubChem CID 55520934) has the molecular formula C19H20N2O3 and a molecular weight of 324.38 g/mol. Its IUPAC name is N-benzyl-N-butan-2-yl-5-(furan-2-yl)-1,2-oxazole-3-carboxamide.
| Compound Name | N-benzyl-N-butan-2-yl-5-(furan-2-yl)-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 55520934 |
| Molecular Formula | C19H20N2O3 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.15 |
| IUPAC Name | N-benzyl-N-butan-2-yl-5-(furan-2-yl)-1,2-oxazole-3-carboxamide |
| SMILES | CCC(C)N(Cc1ccccc1)C(=O)c1cc(-c2ccco2)on1 |
| InChI | InChI=1S/C19H20N2O3/c1-3-14(2)21(13-15-8-5-4-6-9-15)19(22)16-12-18(24-20-16)17-10-7-11-23-17/h4-12,14H,3,13H2,1-2H3 |
| InChIKey | FPZZVCZNEKXSMB-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 59.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |