C19H21N3O3 — CID 24667471
N-[3-(N-ethylanilino)propyl]-5-(furan-2-yl)-1,2-oxazole-3-carboxamide (PubChem CID 24667471) has the molecular formula C19H21N3O3 and a molecular weight of 339.40 g/mol. Its IUPAC name is N-[3-(N-ethylanilino)propyl]-5-(furan-2-yl)-1,2-oxazole-3-carboxamide.
| Compound Name | N-[3-(N-ethylanilino)propyl]-5-(furan-2-yl)-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 24667471 |
| Molecular Formula | C19H21N3O3 |
| Molecular Weight | 339.40 g/mol |
| Exact Mass | 339.16 |
| IUPAC Name | N-[3-(N-ethylanilino)propyl]-5-(furan-2-yl)-1,2-oxazole-3-carboxamide |
| SMILES | CCN(CCCNC(=O)c1cc(-c2ccco2)on1)c1ccccc1 |
| InChI | InChI=1S/C19H21N3O3/c1-2-22(15-8-4-3-5-9-15)12-7-11-20-19(23)16-14-18(25-21-16)17-10-6-13-24-17/h3-6,8-10,13-14H,2,7,11-12H2,1H3,(H,20,23) |
| InChIKey | CNQGQICZBBGFLA-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 71.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.40 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|