C19H18F3N3O5 — CID 57383747
5-(furan-2-yl)-N-(4-pyridin-4-ylbutyl)-1,2-oxazole-3-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 57383747) has the molecular formula C19H18F3N3O5 and a molecular weight of 425.36 g/mol. Its IUPAC name is 5-(furan-2-yl)-N-(4-pyridin-4-ylbutyl)-1,2-oxazole-3-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | 5-(furan-2-yl)-N-(4-pyridin-4-ylbutyl)-1,2-oxazole-3-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 57383747 |
| Molecular Formula | C19H18F3N3O5 |
| Molecular Weight | 425.36 g/mol |
| Exact Mass | 425.12 |
| IUPAC Name | 5-(furan-2-yl)-N-(4-pyridin-4-ylbutyl)-1,2-oxazole-3-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | O=C(NCCCCc1ccncc1)c1cc(-c2ccco2)on1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C17H17N3O3.C2HF3O2/c21-17(14-12-16(23-20-14)15-5-3-11-22-15)19-8-2-1-4-13-6-9-18-10-7-13;3-2(4,5)1(6)7/h3,5-7,9-12H,1-2,4,8H2,(H,19,21);(H,6,7) |
| InChIKey | NSSUGZTWQJDBMH-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 118.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.36 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|