C16H14N2O3 — CID 58128735
1-[5-(furan-2-yl)-1,2-oxazol-3-yl]-4-pyridin-4-ylbutan-1-one (PubChem CID 58128735) has the molecular formula C16H14N2O3 and a molecular weight of 282.30 g/mol. Its IUPAC name is 1-[5-(furan-2-yl)-1,2-oxazol-3-yl]-4-pyridin-4-ylbutan-1-one.
| Compound Name | 1-[5-(furan-2-yl)-1,2-oxazol-3-yl]-4-pyridin-4-ylbutan-1-one |
|---|---|
| PubChem CID | 58128735 |
| Molecular Formula | C16H14N2O3 |
| Molecular Weight | 282.30 g/mol |
| Exact Mass | 282.10 |
| IUPAC Name | 1-[5-(furan-2-yl)-1,2-oxazol-3-yl]-4-pyridin-4-ylbutan-1-one |
| SMILES | O=C(CCCc1ccncc1)c1cc(-c2ccco2)on1 |
| InChI | InChI=1S/C16H14N2O3/c19-14(4-1-3-12-6-8-17-9-7-12)13-11-16(21-18-13)15-5-2-10-20-15/h2,5-11H,1,3-4H2 |
| InChIKey | JQNKNCICKQARFU-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 69.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.30 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |