C20H25N3O2S — CID 55522169
(E)-N-[2-(2-methoxyphenyl)-2-pyrrolidin-1-ylethyl]-3-(2-methyl-1,3-thiazol-4-yl)prop-2-enamide (PubChem CID 55522169) has the molecular formula C20H25N3O2S and a molecular weight of 371.51 g/mol. Its IUPAC name is (E)-N-[2-(2-methoxyphenyl)-2-pyrrolidin-1-ylethyl]-3-(2-methyl-1,3-thiazol-4-yl)prop-2-enamide.
| Compound Name | (E)-N-[2-(2-methoxyphenyl)-2-pyrrolidin-1-ylethyl]-3-(2-methyl-1,3-thiazol-4-yl)prop-2-enamide |
|---|---|
| PubChem CID | 55522169 |
| Molecular Formula | C20H25N3O2S |
| Molecular Weight | 371.51 g/mol |
| Exact Mass | 371.17 |
| IUPAC Name | (E)-N-[2-(2-methoxyphenyl)-2-pyrrolidin-1-ylethyl]-3-(2-methyl-1,3-thiazol-4-yl)prop-2-enamide |
| SMILES | COc1ccccc1C(CNC(=O)/C=C/c1csc(C)n1)N1CCCC1 |
| InChI | InChI=1S/C20H25N3O2S/c1-15-22-16(14-26-15)9-10-20(24)21-13-18(23-11-5-6-12-23)17-7-3-4-8-19(17)25-2/h3-4,7-10,14,18H,5-6,11-13H2,1-2H3,(H,21,24)/b10-9+ |
| InChIKey | CTVNKFBLKMHWFB-MDZDMXLPSA-N |
| XLogP | 3.43 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.51 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|