C21H23N5O3S — CID 55522395
3-[3-(furan-2-yl)-5-[2-oxo-2-(1,2,3,4-tetrahydronaphthalen-1-ylamino)ethyl]sulfanyl-1,2,4-triazol-4-yl]propanamide (PubChem CID 55522395) has the molecular formula C21H23N5O3S and a molecular weight of 425.51 g/mol. Its IUPAC name is 3-[3-(furan-2-yl)-5-[2-oxo-2-(1,2,3,4-tetrahydronaphthalen-1-ylamino)ethyl]sulfanyl-1,2,4-triazol-4-yl]propanamide.
| Compound Name | 3-[3-(furan-2-yl)-5-[2-oxo-2-(1,2,3,4-tetrahydronaphthalen-1-ylamino)ethyl]sulfanyl-1,2,4-triazol-4-yl]propanamide |
|---|---|
| PubChem CID | 55522395 |
| Molecular Formula | C21H23N5O3S |
| Molecular Weight | 425.51 g/mol |
| Exact Mass | 425.15 |
| IUPAC Name | 3-[3-(furan-2-yl)-5-[2-oxo-2-(1,2,3,4-tetrahydronaphthalen-1-ylamino)ethyl]sulfanyl-1,2,4-triazol-4-yl]propanamide |
| SMILES | NC(=O)CCn1c(SCC(=O)NC2CCCc3ccccc32)nnc1-c1ccco1 |
| InChI | InChI=1S/C21H23N5O3S/c22-18(27)10-11-26-20(17-9-4-12-29-17)24-25-21(26)30-13-19(28)23-16-8-3-6-14-5-1-2-7-15(14)16/h1-2,4-5,7,9,12,16H,3,6,8,10-11,13H2,(H2,22,27)(H,23,28) |
| InChIKey | GZCJZPFJVSPSIH-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 116.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.51 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |