C23H22N4O2S — CID 55523213
N-[2-[3-(2-methylbenzimidazol-1-yl)propylcarbamoyl]phenyl]thiophene-3-carboxamide (PubChem CID 55523213) has the molecular formula C23H22N4O2S and a molecular weight of 418.52 g/mol. Its IUPAC name is N-[2-[3-(2-methylbenzimidazol-1-yl)propylcarbamoyl]phenyl]thiophene-3-carboxamide.
| Compound Name | N-[2-[3-(2-methylbenzimidazol-1-yl)propylcarbamoyl]phenyl]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 55523213 |
| Molecular Formula | C23H22N4O2S |
| Molecular Weight | 418.52 g/mol |
| Exact Mass | 418.15 |
| IUPAC Name | N-[2-[3-(2-methylbenzimidazol-1-yl)propylcarbamoyl]phenyl]thiophene-3-carboxamide |
| SMILES | Cc1nc2ccccc2n1CCCNC(=O)c1ccccc1NC(=O)c1ccsc1 |
| InChI | InChI=1S/C23H22N4O2S/c1-16-25-20-9-4-5-10-21(20)27(16)13-6-12-24-23(29)18-7-2-3-8-19(18)26-22(28)17-11-14-30-15-17/h2-5,7-11,14-15H,6,12-13H2,1H3,(H,24,29)(H,26,28) |
| InChIKey | GGYKQLCKORMYMH-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.52 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|