C19H21ClN4O4 — CID 55523322
[1-oxo-1-(4-pyrimidin-2-ylpiperazin-1-yl)propan-2-yl] 2-(3-chlorophenoxy)acetate (PubChem CID 55523322) has the molecular formula C19H21ClN4O4 and a molecular weight of 404.85 g/mol. Its IUPAC name is [1-oxo-1-(4-pyrimidin-2-ylpiperazin-1-yl)propan-2-yl] 2-(3-chlorophenoxy)acetate.
| Compound Name | [1-oxo-1-(4-pyrimidin-2-ylpiperazin-1-yl)propan-2-yl] 2-(3-chlorophenoxy)acetate |
|---|---|
| PubChem CID | 55523322 |
| Molecular Formula | C19H21ClN4O4 |
| Molecular Weight | 404.85 g/mol |
| Exact Mass | 404.13 |
| IUPAC Name | [1-oxo-1-(4-pyrimidin-2-ylpiperazin-1-yl)propan-2-yl] 2-(3-chlorophenoxy)acetate |
| SMILES | CC(OC(=O)COc1cccc(Cl)c1)C(=O)N1CCN(c2ncccn2)CC1 |
| InChI | InChI=1S/C19H21ClN4O4/c1-14(28-17(25)13-27-16-5-2-4-15(20)12-16)18(26)23-8-10-24(11-9-23)19-21-6-3-7-22-19/h2-7,12,14H,8-11,13H2,1H3 |
| InChIKey | UCUDTXWJAFWMHW-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 84.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.85 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |