C26H28N4O5 — CID 55525968
[1-oxo-1-(4-pyrimidin-2-ylpiperazin-1-yl)propan-2-yl] 2-(4-phenylmethoxyphenoxy)acetate (PubChem CID 55525968) has the molecular formula C26H28N4O5 and a molecular weight of 476.53 g/mol. Its IUPAC name is [1-oxo-1-(4-pyrimidin-2-ylpiperazin-1-yl)propan-2-yl] 2-(4-phenylmethoxyphenoxy)acetate.
| Compound Name | [1-oxo-1-(4-pyrimidin-2-ylpiperazin-1-yl)propan-2-yl] 2-(4-phenylmethoxyphenoxy)acetate |
|---|---|
| PubChem CID | 55525968 |
| Molecular Formula | C26H28N4O5 |
| Molecular Weight | 476.53 g/mol |
| Exact Mass | 476.21 |
| IUPAC Name | [1-oxo-1-(4-pyrimidin-2-ylpiperazin-1-yl)propan-2-yl] 2-(4-phenylmethoxyphenoxy)acetate |
| SMILES | CC(OC(=O)COc1ccc(OCc2ccccc2)cc1)C(=O)N1CCN(c2ncccn2)CC1 |
| InChI | InChI=1S/C26H28N4O5/c1-20(25(32)29-14-16-30(17-15-29)26-27-12-5-13-28-26)35-24(31)19-34-23-10-8-22(9-11-23)33-18-21-6-3-2-4-7-21/h2-13,20H,14-19H2,1H3 |
| InChIKey | LAJUDLDYQGOUJG-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 94.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.53 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |