C16H15FIN3O2 — CID 55523749
2-[(E)-[amino-(4-fluorophenyl)methylidene]amino]oxy-N-(4-iodophenyl)propanamide (PubChem CID 55523749) has the molecular formula C16H15FIN3O2 and a molecular weight of 427.22 g/mol. Its IUPAC name is 2-[(E)-[amino-(4-fluorophenyl)methylidene]amino]oxy-N-(4-iodophenyl)propanamide.
| Compound Name | 2-[(E)-[amino-(4-fluorophenyl)methylidene]amino]oxy-N-(4-iodophenyl)propanamide |
|---|---|
| PubChem CID | 55523749 |
| Molecular Formula | C16H15FIN3O2 |
| Molecular Weight | 427.22 g/mol |
| Exact Mass | 427.02 |
| IUPAC Name | 2-[(E)-[amino-(4-fluorophenyl)methylidene]amino]oxy-N-(4-iodophenyl)propanamide |
| SMILES | CC(O/N=C(/N)c1ccc(F)cc1)C(=O)Nc1ccc(I)cc1 |
| InChI | InChI=1S/C16H15FIN3O2/c1-10(16(22)20-14-8-6-13(18)7-9-14)23-21-15(19)11-2-4-12(17)5-3-11/h2-10H,1H3,(H2,19,21)(H,20,22) |
| InChIKey | VHJFDBGGACIUSM-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 76.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.22 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|