C20H29N5O4S — CID 55523991
tert-butyl N-[4-oxo-4-[4-[(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)methyl]piperazin-1-yl]butyl]carbamate (PubChem CID 55523991) has the molecular formula C20H29N5O4S and a molecular weight of 435.55 g/mol. Its IUPAC name is tert-butyl N-[4-oxo-4-[4-[(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)methyl]piperazin-1-yl]butyl]carbamate.
| Compound Name | tert-butyl N-[4-oxo-4-[4-[(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)methyl]piperazin-1-yl]butyl]carbamate |
|---|---|
| PubChem CID | 55523991 |
| Molecular Formula | C20H29N5O4S |
| Molecular Weight | 435.55 g/mol |
| Exact Mass | 435.19 |
| IUPAC Name | tert-butyl N-[4-oxo-4-[4-[(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)methyl]piperazin-1-yl]butyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCC(=O)N1CCN(Cc2nc(-c3cccs3)no2)CC1 |
| InChI | InChI=1S/C20H29N5O4S/c1-20(2,3)28-19(27)21-8-4-7-17(26)25-11-9-24(10-12-25)14-16-22-18(23-29-16)15-6-5-13-30-15/h5-6,13H,4,7-12,14H2,1-3H3,(H,21,27) |
| InChIKey | GOEZQRIUGJXILK-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 100.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.55 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|