C22H23N5O3S — CID 55528226
(E)-N-[2-oxo-2-[4-[(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)methyl]piperazin-1-yl]ethyl]-3-phenylprop-2-enamide (PubChem CID 55528226) has the molecular formula C22H23N5O3S and a molecular weight of 437.53 g/mol. Its IUPAC name is (E)-N-[2-oxo-2-[4-[(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)methyl]piperazin-1-yl]ethyl]-3-phenylprop-2-enamide.
| Compound Name | (E)-N-[2-oxo-2-[4-[(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)methyl]piperazin-1-yl]ethyl]-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 55528226 |
| Molecular Formula | C22H23N5O3S |
| Molecular Weight | 437.53 g/mol |
| Exact Mass | 437.15 |
| IUPAC Name | (E)-N-[2-oxo-2-[4-[(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)methyl]piperazin-1-yl]ethyl]-3-phenylprop-2-enamide |
| SMILES | O=C(/C=C/c1ccccc1)NCC(=O)N1CCN(Cc2nc(-c3cccs3)no2)CC1 |
| InChI | InChI=1S/C22H23N5O3S/c28-19(9-8-17-5-2-1-3-6-17)23-15-21(29)27-12-10-26(11-13-27)16-20-24-22(25-30-20)18-7-4-14-31-18/h1-9,14H,10-13,15-16H2,(H,23,28)/b9-8+ |
| InChIKey | DZAGTLZCVDTBQB-CMDGGOBGSA-N |
| XLogP | 2.27 |
| TPSA | 91.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.53 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|