C23H28N4O2S — CID 55525464
2-[[4-(3,4-dimethylphenyl)-5-phenyl-1,2,4-triazol-3-yl]sulfanyl]-N-(3-methoxypropyl)propanamide (PubChem CID 55525464) has the molecular formula C23H28N4O2S and a molecular weight of 424.57 g/mol. Its IUPAC name is 2-[[4-(3,4-dimethylphenyl)-5-phenyl-1,2,4-triazol-3-yl]sulfanyl]-N-(3-methoxypropyl)propanamide.
| Compound Name | 2-[[4-(3,4-dimethylphenyl)-5-phenyl-1,2,4-triazol-3-yl]sulfanyl]-N-(3-methoxypropyl)propanamide |
|---|---|
| PubChem CID | 55525464 |
| Molecular Formula | C23H28N4O2S |
| Molecular Weight | 424.57 g/mol |
| Exact Mass | 424.19 |
| IUPAC Name | 2-[[4-(3,4-dimethylphenyl)-5-phenyl-1,2,4-triazol-3-yl]sulfanyl]-N-(3-methoxypropyl)propanamide |
| SMILES | COCCCNC(=O)C(C)Sc1nnc(-c2ccccc2)n1-c1ccc(C)c(C)c1 |
| InChI | InChI=1S/C23H28N4O2S/c1-16-11-12-20(15-17(16)2)27-21(19-9-6-5-7-10-19)25-26-23(27)30-18(3)22(28)24-13-8-14-29-4/h5-7,9-12,15,18H,8,13-14H2,1-4H3,(H,24,28) |
| InChIKey | KCSLHWODRNANPI-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.57 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|