C23H32N4O6S — CID 55529155
5-(diethylaminomethyl)-N'-[3-(4-morpholin-4-ylsulfonylphenyl)propanoyl]furan-2-carbohydrazide (PubChem CID 55529155) has the molecular formula C23H32N4O6S and a molecular weight of 492.60 g/mol. Its IUPAC name is 5-(diethylaminomethyl)-N'-[3-(4-morpholin-4-ylsulfonylphenyl)propanoyl]furan-2-carbohydrazide.
| Compound Name | 5-(diethylaminomethyl)-N'-[3-(4-morpholin-4-ylsulfonylphenyl)propanoyl]furan-2-carbohydrazide |
|---|---|
| PubChem CID | 55529155 |
| Molecular Formula | C23H32N4O6S |
| Molecular Weight | 492.60 g/mol |
| Exact Mass | 492.20 |
| IUPAC Name | 5-(diethylaminomethyl)-N'-[3-(4-morpholin-4-ylsulfonylphenyl)propanoyl]furan-2-carbohydrazide |
| SMILES | CCN(CC)Cc1ccc(C(=O)NNC(=O)CCc2ccc(S(=O)(=O)N3CCOCC3)cc2)o1 |
| InChI | InChI=1S/C23H32N4O6S/c1-3-26(4-2)17-19-8-11-21(33-19)23(29)25-24-22(28)12-7-18-5-9-20(10-6-18)34(30,31)27-13-15-32-16-14-27/h5-6,8-11H,3-4,7,12-17H2,1-2H3,(H,24,28)(H,25,29) |
| InChIKey | ALPYUQAYCAURKF-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 121.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.60 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|