C18H21N3O2S — CID 55531425
2,4-dimethyl-6-[2-(4-propoxyphenoxy)ethylsulfanyl]pyrimidine-5-carbonitrile (PubChem CID 55531425) has the molecular formula C18H21N3O2S and a molecular weight of 343.45 g/mol. Its IUPAC name is 2,4-dimethyl-6-[2-(4-propoxyphenoxy)ethylsulfanyl]pyrimidine-5-carbonitrile.
| Compound Name | 2,4-dimethyl-6-[2-(4-propoxyphenoxy)ethylsulfanyl]pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 55531425 |
| Molecular Formula | C18H21N3O2S |
| Molecular Weight | 343.45 g/mol |
| Exact Mass | 343.14 |
| IUPAC Name | 2,4-dimethyl-6-[2-(4-propoxyphenoxy)ethylsulfanyl]pyrimidine-5-carbonitrile |
| SMILES | CCCOc1ccc(OCCSc2nc(C)nc(C)c2C#N)cc1 |
| InChI | InChI=1S/C18H21N3O2S/c1-4-9-22-15-5-7-16(8-6-15)23-10-11-24-18-17(12-19)13(2)20-14(3)21-18/h5-8H,4,9-11H2,1-3H3 |
| InChIKey | BEMBHDNPVXLWEX-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 68.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.45 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|