C22H31N3O3S — CID 55535044
N-(2-anilino-3-methylbutyl)-4-(butan-2-ylsulfamoyl)benzamide (PubChem CID 55535044) has the molecular formula C22H31N3O3S and a molecular weight of 417.58 g/mol. Its IUPAC name is N-(2-anilino-3-methylbutyl)-4-(butan-2-ylsulfamoyl)benzamide.
| Compound Name | N-(2-anilino-3-methylbutyl)-4-(butan-2-ylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 55535044 |
| Molecular Formula | C22H31N3O3S |
| Molecular Weight | 417.58 g/mol |
| Exact Mass | 417.21 |
| IUPAC Name | N-(2-anilino-3-methylbutyl)-4-(butan-2-ylsulfamoyl)benzamide |
| SMILES | CCC(C)NS(=O)(=O)c1ccc(C(=O)NCC(Nc2ccccc2)C(C)C)cc1 |
| InChI | InChI=1S/C22H31N3O3S/c1-5-17(4)25-29(27,28)20-13-11-18(12-14-20)22(26)23-15-21(16(2)3)24-19-9-7-6-8-10-19/h6-14,16-17,21,24-25H,5,15H2,1-4H3,(H,23,26) |
| InChIKey | WICXCCMJTHEFPW-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.58 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |