C24H23FN4O4S — CID 55535256
N-[4-(cyclopropylcarbamoylamino)phenyl]-5-[(2-fluorophenyl)sulfamoyl]-2-methylbenzamide (PubChem CID 55535256) has the molecular formula C24H23FN4O4S and a molecular weight of 482.54 g/mol. Its IUPAC name is N-[4-(cyclopropylcarbamoylamino)phenyl]-5-[(2-fluorophenyl)sulfamoyl]-2-methylbenzamide.
| Compound Name | N-[4-(cyclopropylcarbamoylamino)phenyl]-5-[(2-fluorophenyl)sulfamoyl]-2-methylbenzamide |
|---|---|
| PubChem CID | 55535256 |
| Molecular Formula | C24H23FN4O4S |
| Molecular Weight | 482.54 g/mol |
| Exact Mass | 482.14 |
| IUPAC Name | N-[4-(cyclopropylcarbamoylamino)phenyl]-5-[(2-fluorophenyl)sulfamoyl]-2-methylbenzamide |
| SMILES | Cc1ccc(S(=O)(=O)Nc2ccccc2F)cc1C(=O)Nc1ccc(NC(=O)NC2CC2)cc1 |
| InChI | InChI=1S/C24H23FN4O4S/c1-15-6-13-19(34(32,33)29-22-5-3-2-4-21(22)25)14-20(15)23(30)26-16-7-9-17(10-8-16)27-24(31)28-18-11-12-18/h2-10,13-14,18,29H,11-12H2,1H3,(H,26,30)(H2,27,28,31) |
| InChIKey | FGYPQMABCDXGLV-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 116.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.54 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |