C22H25N3O4 — CID 55536539
(4-tert-butyl-2-methylphenyl) 2,4-dioxo-1-propylpyrido[2,3-d]pyrimidine-6-carboxylate (PubChem CID 55536539) has the molecular formula C22H25N3O4 and a molecular weight of 395.46 g/mol. Its IUPAC name is (4-tert-butyl-2-methylphenyl) 2,4-dioxo-1-propylpyrido[2,3-d]pyrimidine-6-carboxylate.
| Compound Name | (4-tert-butyl-2-methylphenyl) 2,4-dioxo-1-propylpyrido[2,3-d]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 55536539 |
| Molecular Formula | C22H25N3O4 |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.18 |
| IUPAC Name | (4-tert-butyl-2-methylphenyl) 2,4-dioxo-1-propylpyrido[2,3-d]pyrimidine-6-carboxylate |
| SMILES | CCCn1c(=O)[nH]c(=O)c2cc(C(=O)Oc3ccc(C(C)(C)C)cc3C)cnc21 |
| InChI | InChI=1S/C22H25N3O4/c1-6-9-25-18-16(19(26)24-21(25)28)11-14(12-23-18)20(27)29-17-8-7-15(10-13(17)2)22(3,4)5/h7-8,10-12H,6,9H2,1-5H3,(H,24,26,28) |
| InChIKey | FKJLOHCSNARSSY-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 94.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|