C23H21F3N4O3S — CID 55537571
(E)-3-[4-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]-N-[5-methyl-2-[3-(trifluoromethyl)phenyl]pyrazol-3-yl]prop-2-enamide (PubChem CID 55537571) has the molecular formula C23H21F3N4O3S and a molecular weight of 490.51 g/mol. Its IUPAC name is (E)-3-[4-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]-N-[5-methyl-2-[3-(trifluoromethyl)phenyl]pyrazol-3-yl]prop-2-enamide.
| Compound Name | (E)-3-[4-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]-N-[5-methyl-2-[3-(trifluoromethyl)phenyl]pyrazol-3-yl]prop-2-enamide |
|---|---|
| PubChem CID | 55537571 |
| Molecular Formula | C23H21F3N4O3S |
| Molecular Weight | 490.51 g/mol |
| Exact Mass | 490.13 |
| IUPAC Name | (E)-3-[4-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]-N-[5-methyl-2-[3-(trifluoromethyl)phenyl]pyrazol-3-yl]prop-2-enamide |
| SMILES | Cc1cc(NC(=O)/C=C/c2ccc(N3CCCS3(=O)=O)cc2)n(-c2cccc(C(F)(F)F)c2)n1 |
| InChI | InChI=1S/C23H21F3N4O3S/c1-16-14-21(30(28-16)20-5-2-4-18(15-20)23(24,25)26)27-22(31)11-8-17-6-9-19(10-7-17)29-12-3-13-34(29,32)33/h2,4-11,14-15H,3,12-13H2,1H3,(H,27,31)/b11-8+ |
| InChIKey | NHNIFBMRFYYCJD-DHZHZOJOSA-N |
| XLogP | 4.39 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.51 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|